BIOPEP-UWM: Report
| ID | 8986 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from bluefin leatherjacket (Navodon septentrionalis) heads. | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 615.6763 | Monoisotopic mass | 615.3007 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chi C. F., Wang B., Wang Y. M., Zhang B., Deng S. J. | |
| Title | |
| Isolation and characterization of three antioxidant peptides from protein hydrolysate of bluefin leatherjacket (Navodon septentrionalis) heads. J. Funct. Foods, 12, 1–10. 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C29H41N7O8/c30-12-4-3-8-22(29(43)44)35-28(42)23-9-5-13-36(23)24(37)16-33-27(41)21(10-11-25(38)39)34-26(40)19(31)14-17-15-32-20-7-2-1-6-18(17)20/h1-2,6-7,15,19,21-23,32H,3-5,8-14,16,30-31H2,(H,33,41)(H,34,40)(H,35,42)(H,38,39)(H,43,44)/t19-,21-,22-,23-/m0/s1 InChIKey=JLDZLHZMCHMDQZ-UDIDDNNKSA-N Bioactivity was determined using the following assays: DPPH, hydroxyl, ABTS, superoxide radicals scavenging. |
| Database reference: |
| FeptideDB: ID 8986 |