BIOPEP-UWM: Report
| ID | 8988 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from bluefin leatherjacket (Navodon septentrionalis) heads. | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 485.5728 | Monoisotopic mass | 485.2840 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chi C. F., Wang B., Wang Y. M., Zhang B., Deng S. J. | |
| Title | |
| Isolation and characterization of three antioxidant peptides from protein hydrolysate of bluefin leatherjacket (Navodon septentrionalis) heads. J. Funct. Foods, 12, 1–10, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C22H39N5O7/c1-11(2)9-14(19(30)26-18(13(5)28)22(33)34)24-20(31)15-7-6-8-27(15)21(32)17(12(3)4)25-16(29)10-23/h11-15,17-18,28H,6-10,23H2,1-5H3,(H,24,31)(H,25,29)(H,26,30)(H,33,34)/t13-,14+,15+,17+,18+/m1/s1 InChIKey=SNHRYEUGNDNXLC-RCMKLKEOSA-N Bioactivity was determined using the following assays: DPPH, hydroxyl, ABTS, superoxide radicals scavenging. |
| Database reference: |
| FeptideDB: ID 8988 |