BIOPEP-UWM: Report
| ID | 8989 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from hemp (Cannabis sativa L.) seed. | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 483.5570 | Monoisotopic mass | 483.2684 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Girgih A. T., He R., Malomo S., Offengenden M., Wu J., Aluko R. E. | |
| Title | |
| Structural and functional characterization of hemp seed (Cannabis sativa L.) protein-derived antioxidant and antihypertensive peptides. J. Funct. Foods, 6, 384–394, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C22H37N5O7/c1-12(2)10-15(25-19(30)16(11-28)26-18(29)14-6-4-8-23-14)21(32)27-9-5-7-17(27)20(31)24-13(3)22(33)34/h12-17,23,28H,4-11H2,1-3H3,(H,24,31)(H,25,30)(H,26,29)(H,33,34)/t13-,14-,15-,16-,17-/m0/s1 InChIKey=WAYKZVCWGHRLII-WOYTXXSLSA-N Bioactivity was determined using the fDPPH radicals scavenging assay. BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C22H37N5O7/c1-12(2)10-15(25-19(30)16(11-28)26-18(29)14-6-4-8-23-14)21(32)27-9-5-7-17(27)20(31)24-13(3)22(33)34/h12-17,23,28H,4-11H2,1-3H3,(H,24,31)(H,25,30)(H,26,29)(H,33,34)/t13-,14-,15-,16-,17-/m0/s1 InChIKey=WAYKZVCWGHRLII-WOYTXXSLSA-N Bioactivity was determined using the fDPPH radicals scavenging assay. |
| Database reference: |
| FeptideDB: ID 8989 |