BIOPEP-UWM: Report
| ID | 8992 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from Sphyrna lewini muscle. | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 667.7507 | Monoisotopic mass | 667.3319 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang B., Li Z. R., Chi C. F., Zhang Q. H., Luo H. Y. | |
| Title | |
| Preparation and evaluation of antioxidant peptides from ethanol-soluble proteins hydrolysate of Sphyrna lewini muscle. Peptides, 36, 240–250, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C33H45N7O8/c34-15-5-4-9-24(33(47)48)37-32(46)27(19-28(35)42)40-31(45)25(17-20-7-2-1-3-8-20)39-30(44)26(18-21-11-13-22(41)14-12-21)38-29(43)23-10-6-16-36-23/h1-3,7-8,11-14,23-27,36,41H,4-6,9-10,15-19,34H2,(H2,35,42)(H,37,46)(H,38,43)(H,39,44)(H,40,45)(H,47,48)/t23-,24-,25-,26-,27-/m0/s1 InChIKey=IXGCHHJCLCDJOZ-IRGGMKSGSA-N Bioactivity was determined using the following assays: ABTS, DPPH radicals scavenging. |
| Database reference: |
| FeptideDB: ID 8992 |