BIOPEP-UWM: Report
| ID | 8993 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from corn gluten meal. | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 488.6180 | Monoisotopic mass | 488.2989 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhuang H., Tang N., Yuan Y. | |
| Title | |
| Purification and identification of antioxidant peptides from corn gluten meal. J. Funct. Foods, 5, 1810–1821, 2013 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC1=CC=CC=C1)C(O)=O InChI=1S/C26H40N4O5/c1-16(2)13-19(27)23(31)28-20(14-17(3)4)25(33)30-12-8-11-22(30)24(32)29-21(26(34)35)15-18-9-6-5-7-10-18/h5-7,9-10,16-17,19-22H,8,11-15,27H2,1-4H3,(H,28,31)(H,29,32)(H,34,35)/t19-,20-,21-,22-/m0/s1 InChIKey=NSBRAKJUOARNNR-CMOCDZPBSA-N Bioactivity was determined using the following assays: DPPH, ABTS, and hydroxyl radicals scavenging. Anti-inflammatory peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9861), the EROP-Moscow database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9861 EROP-Moscow: ID E23779 FeptideDB: ID 8993 |