BIOPEP-UWM: Report
| ID | 8994 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from oyster (Saccostrea cucullata). | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 515.6020 | Monoisotopic mass | 515.3058 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Umayaparvathi S., Meenakshi S., Vimalraj V., Arumugam M., Sivagami G., Balasubramanian T. | |
| Title | |
| The Structure-Activity Relationship of the Antioxidant Peptides from Natural Proteins. Molecules, 21, 72, 1-14. | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C22H41N7O7/c1-11(2)9-14(24)20(33)26-12(3)19(32)29-16(10-17(25)30)21(34)27-13(4)18(31)28-15(22(35)36)7-5-6-8-23/h11-16H,5-10,23-24H2,1-4H3,(H2,25,30)(H,26,33)(H,27,34)(H,28,31)(H,29,32)(H,35,36)/t12-,13-,14-,15-,16-/m0/s1 InChIKey=MNGKDJPGEUTILH-QXKUPLGCSA-N Bioactivity was determined using the following assays: DPPH radicals scavenging, Inhibiting human colon carcinoma (HT-29) cell lines. |
| Database reference: |