BIOPEP-UWM: Report
| ID | 8996 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from oyster (Saccostrea cucullata). | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1146.4183 | Monoisotopic mass | 1145.7150 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Umayaparvathi S., Meenakshi S., Vimalraj V., Arumugam M., Sivagami G., Balasubramanian T. | |
| Title | |
| Antioxidant activity and anticancer effect of bioactive peptide from enzymatic hydrolysate of oyster (Saccostrea cucullata). Biomed. Prev. Nutr., 4, 343–353, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C55H95N13O13/c1-28(2)22-37(62-49(74)38(23-29(3)4)63-52(77)44(32(9)10)66-47(72)35(16-13-14-20-56)61-51(76)43(57)31(7)8)48(73)60-36(18-19-42(69)70)46(71)64-39(25-34-26-58-27-59-34)54(79)68-21-15-17-41(68)50(75)67-45(33(11)12)53(78)65-40(55(80)81)24-30(5)6/h26-33,35-41,43-45H,13-25,56-57H2,1-12H3,(H,58,59)(H,60,73)(H,61,76)(H,62,74)(H,63,77)(H,64,71)(H,65,78)(H,66,72)(H,67,75)(H,69,70)(H,80,81)/t35-,36-,37-,38-,39-,40-,41-,43-,44-,45-/m0/s1 InChIKey=KBWVNFRHARUDIN-NQYQYAFSSA-N Bioactivity was determined using the following assays: DPPH radicals scavenging, Inhibiting human colon carcinoma (HT-29) cell lines. |
| Database reference: |