BIOPEP-UWM: Report
| ID | 8998 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from corp. | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 504.5745 | Monoisotopic mass | 504.2575 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang C., He H., Zhang J. L., Li X., Ma Z. L. | |
| Title | |
| High performance liquid chromatography (HPLC) fingerprints and primary structure identification of corn peptides by HPLC-diode array detection and HPLC-electrospray ionization tandem mass spectrometry. J. Food Drug. Anal., 24, 95-104, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C25H36N4O7/c1-15(2)13-19(28-22(32)17(26)14-16-7-4-3-5-8-16)24(34)29-12-6-9-20(29)23(33)27-18(25(35)36)10-11-21(30)31/h3-5,7-8,15,17-20H,6,9-14,26H2,1-2H3,(H,27,33)(H,28,32)(H,30,31)(H,35,36)/t17-,18-,19-,20-/m0/s1 InChIKey=ADFHZHFGSVKYPV-MUGJNUQGSA-N |
| Database reference: |