BIOPEP-UWM: Report
| ID | 9009 |
| Name | Antilisterial peptide |
| sequence |
| Function: | |||
| Antibacterial peptide against L. monocytogenes. | |||
| Number of residues | 5 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 662.7603 | Monoisotopic mass | 662.2950 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Castellano P., Mora L., Escudero E., Vignolo G., Aznar R., Toldrá F. | |
| Title | |
| Antilisterial peptides from Spanish dry-cured hams: purification and identification. Food Microbiology, 59, 133-141, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)NCC(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](CCSC)C(=O)O InChI=1S/C28H42N10O7S/c1-46-10-8-20(27(44)45)37-26(43)21(11-16-4-6-18(39)7-5-16)36-23(40)14-34-25(42)22(12-17-13-32-15-35-17)38-24(41)19(29)3-2-9-33-28(30)31/h4-7,13,15,19-22,39H,2-3,8-12,14,29H2,1H3,(H,32,35)(H,34,42)(H,36,40)(H,37,43)(H,38,41)(H,44,45)(H4,30,31,33)/t19-,20-,21-,22-/m0/s1 InChIKey= NGIWSVFQZCZGGV-CMOCDZPBSA-N Peptide derived from dry-cured Spanish ham. Bioactivity expressed as MIC=6.25 mM. |
| Database reference: |