BIOPEP-UWM: Report
| ID | 9010 |
| Name | Antioxidant peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 464.4939 | Monoisotopic mass | 464.1683 | |
| IC50 : | 75.20 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mora L., Escudero E., Fraser P. D., Aristoy M. C., Toldrá F. | |
| Title | |
| Proteomic identification of antioxidant peptides from 400 to 2500 Da generated in Spanish dry-cured ham contained in a size-exclusion chromatography fraction. Food Research International, 56, 68–76, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CS)C(=O)O InChI=1S/C16H28N6O8S/c1-6(12(25)19-7(2)13(26)22-10(5-31)16(29)30)20-15(28)9(3-11(18)24)21-14(27)8(17)4-23/h6-10,23,31H,3-5,17H2,1-2H3,(H2,18,24)(H,19,25)(H,20,28)(H,21,27)(H,22,26)(H,29,30)/t6-,7-,8-,9-,10-/m0/s1 InChIKey= YSIHBLVHNNFCSI-WYCDGMCDSA-N |
| Database reference: |