BIOPEP-UWM: Report
| ID | 9017 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 553.6532 | Monoisotopic mass | 553.3327 | |
| IC50 : | 67.08 µM |
|||
| Bibliographic data: | |
| Authors | |
| Escudero E., Mora L., Toldrá F. | |
| Title | |
| Stability of ACE inhibitory ham peptides against heat treatment and in vitro digestion. Food Chemistry, 161, 305-311, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C24H43N9O6/c25-10-2-1-6-15(26)21(36)32-12-4-8-17(32)20(35)30-14-19(34)31-16(7-3-11-29-24(27)28)22(37)33-13-5-9-18(33)23(38)39/h15-18H,1-14,25-26H2,(H,30,35)(H,31,34)(H,38,39)(H4,27,28,29)/t15-,16-,17-,18-/m0/s1 InChIKey= JSCUUQUXYDVBHH-XSLAGTTESA-N Anti-inflammatory peptide according to the BIOPEP-UWM database of bioactive peptides ID 9957) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9957 EROP-Moscow: ID E24865 |