BIOPEP-UWM: Report
| ID | 9023 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 8 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 726.8589 | Monoisotopic mass | 726.4262 | |
| EC50 : | 106.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lammi C., Zanoni C., Arnoldi A., Vistoli G. | |
| Title | |
| Peptides derived from soy and lupin protein as dipeptidyl-peptidase IV inhibitors: in vitro biochemical screening and in silico molecular modeling study. J. Agric. Food Chem., 2016, 64, 9601–9606 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)O)C)C(C)C)[C@H](O)C)CCC1)C(C)C)C)[C@H](CC)C InChI=1S/C33H58N8O10/c1-10-17(6)23(34)29(46)36-18(7)27(44)39-25(16(4)5)32(49)41-13-11-12-21(41)28(45)40-26(20(9)42)30(47)35-14-22(43)38-24(15(2)3)31(48)37-19(8)33(50)51/h15-21,23-26,42H,10-14,34H2,1-9H3,(H,35,47)(H,36,46)(H,37,48)(H,38,43)(H,39,44)(H,40,45)(H,50,51)/t17-,18-,19-,20+,21-,23-,24-,25-,26-/m0/s1 InChIKey: HWGBHHZSKLLIDB-PQQRXNHQSA-N |
| Database reference: |