BIOPEP-UWM: Report
| ID | 9024 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 9 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 935.9713 | Monoisotopic mass | 935.4221 | |
| IC50 : | 228.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lammi C., Zanoni C., Arnoldi A., Vistoli G. | |
| Title | |
| Peptides derived from soy and lupin protein as dipeptidyl-peptidase IV inhibitors: in vitro biochemical screening and in silico molecular modeling study. J. Agric. Food Chem., 2016, 64, 9601–9606 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(C)C)C(=O)N[C@@H](C(O)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N1[C@@H](CCC1)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O InChI=1S/C41H61N9O16/c1-20(2)15-24(42)35(59)49-33(22(4)52)39(63)47-26(16-23-9-6-5-7-10-23)40(64)50-14-8-11-29(50)38(62)43-18-30(53)45-28(19-51)37(61)44-21(3)34(58)46-25(12-13-31(54)55)36(60)48-27(41(65)66)17-32(56)57/h5-7,9-10,20-22,24-29,33,51-52H,8,11-19,42H2,1-4H3,(H,43,62)(H,44,61)(H,45,53)(H,46,58)(H,47,63)(H,48,60)(H,49,59)(H,54,55)(H,56,57)(H,65,66)/t21-,22?,24-,25-,26-,27-,28-,29-,33-/m0/s1 InChIKey: IBTVFVCXPZUCFW-KZXSYCCGSA-N |
| Database reference: |