BIOPEP-UWM: Report
| ID | 9039 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 391.5031 | Monoisotopic mass | 391.2463 | |
| IC50 : | 44.67 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kuba M., Tanaka K., Tawata S., Takeda Y., Yasuda M. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory peptides isolated from tofuyo fermented soybean food. Biosci. Biotech. Biochem., 67, 1278-1283, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)Cc1ccccc1)[C@H](CC)C InChI=1S/C21H33N3O4/c1-5-14(4)18(22)20(26)23-16(12-15-9-7-6-8-10-15)19(25)24-17(21(27)28)11-13(2)3/h6-10,13-14,16-18H,5,11-12,22H2,1-4H3,(H,23,26)(H,24,25)(H,27,28)/t14-,16-,17-,18-/m0/s1 InChIKey: XLXPYSDGMXTTNQ-DKIMLUQUSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M02-001 |
| Database reference: |
| AHTPDB: ID 1564, 1899, 2967, 4818, 5118, 5215, 6215, 6861 BioPepDB: ID biopep00509 EROP-Moscow: ID E06384 J-GLOBAL: ID 200907006650160434 Nikkaji: ID J1.913.865H SATPdb: ID satpdb22535 |