BIOPEP-UWM: Report
| ID | 9055 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 425.5421 | Monoisotopic mass | 425.1977 | |
| IC50 : | 1.82 µM |
|||
| Bibliographic data: | |
| Authors | |
| Matsui T., Yukiyoshi A., Doi S., Sugimoto H., Yamada H., Matsumoto K. | |
| Title | |
| Gastrointestinal enzyme production of bioactive peptides from royal jelly protein and their antihypertensive ability in SHR. J. Nutr. Biochem., 13, 80-86, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)Cc1ccc(cc1)O)CCSC)[C@H](CC)C InChI=1S/C20H31N3O5S/c1-4-12(2)17(21)19(26)22-15(9-10-29-3)18(25)23-16(20(27)28)11-13-5-7-14(24)8-6-13/h5-8,12,15-17,24H,4,9-11,21H2,1-3H3,(H,22,26)(H,23,25)(H,27,28)/t12-,15-,16-,17-/m0/s1 InChIKey: UOPBQSJRBONRON-STECZYCISA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M02-001 |
| Database reference: |
| AHTPDB: ID 1614, 2676 BioPepDB: ID biopep00545 ChemSpider: ID 7999483 EROP-Moscow: ID E14472 PubChem: CID 9823736 SATPdb: ID satpdb28699 |