BIOPEP-UWM: Report
| ID | 9162 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 362.4880 | Monoisotopic mass | 362.1981 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tian M., Fang B., Jiang L., Guo H., Cui J., Ren F. | |
| Title | |
| Structure-activity relationship of a series of antioxidant tripeptides derived from β-lactoglobulin using QSAR modeling. Dairy Science and Technology (2015) 95: 451–463. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI= 1S/C15H30N4O4S/c1-9(2)7-11(15(22)23)18-14(21)12(8-24)19-13(20)10(17)5-3-4-6-16/h9-12,24H,3-8,16-17H2,1-2H3,(H,18,21)(H,19,20)(H,22,23)/t10-,11-,12-/m0/s1 InChIKey: SSYOBDBNBQBSQE-SRVKXCTJSA-N Relative antioxidative activity was: 11.19 mmol Fe/mol peptide |
| Database reference: |