BIOPEP-UWM: Report
| ID | 9164 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 249.2879 | Monoisotopic mass | 249.0780 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tian M., Fang B., Jiang L., Guo H., Cui J., Ren F. | |
| Title | |
| Structure-activity relationship of a series of antioxidant tripeptides derived from β-lactoglobulin using QSAR modeling. Dairy Science and Technology (2015) 95: 451–463. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CS)C(=O)NCC(=O)N[C@@]([H])(C)C(O)=O InChI= 1S/C8H15N3O4S/c1-4(8(14)15)11-6(12)2-10-7(13)5(9)3-16/h4-5,16H,2-3,9H2,1H3,(H,10,13)(H,11,12)(H,14,15)/t4-,5-/m0/s1 InChIKey: CVLIHKBUPSFRQP-WHFBIAKZSA-N Relative antioxidative activity was: 12.04 mmol Fe/mol peptide |
| Database reference: |