BIOPEP-UWM: Report
| ID | 9167 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 447.4408 | Monoisotopic mass | 447.1748 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tian M., Fang B., Jiang L., Guo H., Cui J., Ren F. | |
| Title | |
| Structure-activity relationship of a series of antioxidant tripeptides derived from β-lactoglobulin using QSAR modeling. Dairy Science and Technology (2015) 95: 451–463. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1c[nH]c2ccccc12)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(CC(N)=O)C(O)=O InChI= 1S/C20H25N5O7/c21-12(7-10-9-23-13-4-2-1-3-11(10)13)18(29)24-14(5-6-17(27)28)19(30)25-15(20(31)32)8-16(22)26/h1-4,9,12,14-15,23H,5-8,21H2,(H2,22,26)(H,24,29)(H,25,30)(H,27,28)(H,31,32)/t12-,14-,15-/m0/s1 InChIKey: OENGVSDBQHHGBU-QEJZJMRPSA-N Relative antioxidative activity was: 20.55 mmol Fe/mol peptide |
| Database reference: |