BIOPEP-UWM: Report
| ID | 9170 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 931.0407 | Monoisotopic mass | 930.4795 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jin D.-X., Liu X., Zheng X., Wang X.,He J. | |
| Title | |
| Preparation of antioxidative corn protein hydrolysates, purification and evaluation of three novel corn antioxidant peptides. Food Chem., 204, 427-436, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C43H66N10O13/c1-23(2)20-30(50-36(58)28(8-4-5-17-44)48-39(61)33-10-7-19-53(33)42(64)27(45)21-25-11-13-26(54)14-12-25)37(59)47-24(3)41(63)52-18-6-9-32(52)40(62)51-31(22-34(46)55)38(60)49-29(43(65)66)15-16-35(56)57/h11-14,23-24,27-33,54H,4-10,15-22,44-45H2,1-3H3,(H2,46,55)(H,47,59)(H,48,61)(H,49,60)(H,50,58)(H,51,62)(H,56,57)(H,65,66)/t24-,27-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey: KDOBMVLNKPPIKX-LUTNNBBHSA-N |
| Database reference: |