BIOPEP-UWM: Report
| ID | 9177 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 437.4888 | Monoisotopic mass | 437.2267 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Contreras M. M., Sánchez-Infantes D., Sevilla M. A., Recio I., Amigo L. | |
| Title | |
| Resistance of casein-derived bioactive peptides to simulated gastrointestinal digestión. Int. Dairy J., 32, 71–78, 2013 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCCN)C(=O)O InChI=1S/C20H31N5O6/c21-10-2-1-3-16(20(30)31)25-19(29)15(8-9-17(23)27)24-18(28)14(22)11-12-4-6-13(26)7-5-12/h4-7,14-16,26H,1-3,8-11,21-22H2,(H2,23,27)(H,24,28)(H,25,29)(H,30,31)/t14-,15-,16-/m0/s1 InChIKey=MJSMBGMARRSHGO-XDGMXVDYSA-N InChIKey=WZQZUVWEPMGIMM-JYJNAYRXSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9282); the MBPDB database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9282 EROP-Moscow: ID E25023 MBPDB: Peptide YQK PubChem: CID 14389275 |