BIOPEP-UWM: Report
| ID | 9179 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 406.4319 | Monoisotopic mass | 406.1846 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ohata M., Uchida S., Zhou L., Arihara K. | |
| Title | |
| Antioxidant activity of fermented meat sauce and isolation of an associated antioxidant peptide. Food Chem., 194, 1034-1039, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C19H26N4O6/c20-13(7-8-16(21)25)17(26)22-14(10-11-3-5-12(24)6-4-11)18(27)23-9-1-2-15(23)19(28)29/h3-6,13-15,24H,1-2,7-10,20H2,(H2,21,25)(H,22,26)(H,28,29)/t13-,14-,15-/m0/s1 InChIKey: JTWZNMUVQWWGOX-KKUMJFAQSA-N |
| Database reference: |