BIOPEP-UWM: Report
| ID | 9190 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 406.4992 | Monoisotopic mass | 406.1669 | |
| IC50 : | 16.32 µM |
|||
| Bibliographic data: | |
| Authors | |
| Balti R., Nedjar-Arroume N., Bougatef A., Guillochon D., Nasri M. | |
| Title | |
| Three novel angiotensin I-converting enzyme (ACE) inhibitory peptides from cuttlefish (Sepia officinalis) using digestive proteases. Food Res. Int., 43, 1136-1143, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C19H26N4O4S/c1-11(22-18(25)14(20)7-8-28-2)17(24)23-16(19(26)27)9-12-10-21-15-6-4-3-5-13(12)15/h3-6,10-11,14,16,21H,7-9,20H2,1-2H3,(H,22,25)(H,23,24)(H,26,27)/t11-,14-,16-/m0/s1 InChIKey: PWPBGAJJYJJVPI-PJODQICGSA-N Activator of Angiotensin 2-converting enzyme (ACE2) (EC 3.4.17.23) (MEROPS ID: M02.006) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| AHTPDB: ID 1052, 2827, 2879, 2920, 3712, 4813, 4985, 5240, 5733 ChEBI: ID 160482 EROP-Moscow: ID E24208 J-GLOBAL: ID 201007065754378161 Metabolomics Workbench: ID 83873 Nikkaji: ID J2.844.076F PubChem: CID 50923227 SATPdb: ID satpdb13887 |