BIOPEP-UWM: Report
| ID | 9221 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 636.6509 | Monoisotopic mass | 636.2535 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yousr M., Howell N. | |
| Title | |
| Antioxidant and ACE inhibitory bioactive peptides purified from egg yolk proteins. Int. J. Mol. Sci., 16, 29161–29178, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](Cc1c[nH]c2c1cccc2)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(=O)O)C(=O)O InChI=1S/C31H36N6O9/c32-21(13-18-15-33-22-5-2-1-4-20(18)22)28(42)35-23(12-17-7-9-19(38)10-8-17)29(43)34-16-26(39)37-11-3-6-25(37)30(44)36-24(31(45)46)14-27(40)41/h1-2,4-5,7-10,15,21,23-25,33,38H,3,6,11-14,16,32H2,(H,34,43)(H,35,42)(H,36,44)(H,40,41)(H,45,46)/t21-,23-,24-,25-/m0/s1 InChIKey: MMEBJPJQOBPVCL-LFBFJMOVSA-N |
| Database reference: |