BIOPEP-UWM: Report
| ID | 9226 |
| Name | ACE Inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 952.9225 | Monoisotopic mass | 952.3986 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yousr M., Howell N. | |
| Title | |
| Antioxidant and ACE inhibitory bioactive peptides purified from egg yolk proteins. Int. J. Mol. Sci., 16, 29161–29178, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C37H56N14O16/c38-18(15-52)30(60)49-23(13-29(58)59)35(65)51-22(12-27(41)56)33(63)47-19(2-1-9-44-37(42)43)32(62)50-21(11-26(40)55)34(64)48-20(7-8-25(39)54)31(61)45-14-28(57)46-24(36(66)67)10-16-3-5-17(53)6-4-16/h3-6,18-24,52-53H,1-2,7-15,38H2,(H2,39,54)(H2,40,55)(H2,41,56)(H,45,61)(H,46,57)(H,47,63)(H,48,64)(H,49,60)(H,50,62)(H,51,65)(H,58,59)(H,66,67)(H4,42,43,44)/t18-,19-,20-,21-,22-,23-,24-/m0/s1 InChIKey: BRYBOERJYJAGEE-LQDRYOBXSA-N |
| Database reference: |