BIOPEP-UWM: Report
| ID | 9231 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 10 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1268.4124 | Monoisotopic mass | 1267.6217 | |
| EC50 : | 40.08 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Chen R., Ma H., Chen S. | |
| Title | |
| Isolation and identification of dipeptidyl peptidase IV-inhibitory peptides from trypsin/chymotrypsin-treated goat milk casein hydrolysates by 2D-TLC and LC–MS/MS. Journal of Agricultural and Food Chemistry, 2015, 63, 8819-8828. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)([C@@H](C)CC)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C62H85N13O16/c1-5-34(4)52(66)59(87)70-43(32-51(65)80)56(84)69-42(31-50(64)79)55(83)67-40(23-24-49(63)78)53(81)68-41(28-35-11-7-6-8-12-35)54(82)71-44(27-33(2)3)60(88)74-25-9-13-47(74)57(85)72-45(29-36-15-19-38(76)20-16-36)61(89)75-26-10-14-48(75)58(86)73-46(62(90)91)30-37-17-21-39(77)22-18-37/h6-8,11-12,15-22,33-34,40-48,52,76-77H,5,9-10,13-14,23-32,66H2,1-4H3,(H2,63,78)(H2,64,79)(H2,65,80)(H,67,83)(H,68,81)(H,69,84)(H,70,87)(H,71,82)(H,72,85)(H,73,86)(H,90,91)/t34-,40-,41-,42-,43-,44-,45-,46-,47-,48-,52-/m0/s1 InChIKey: LHNKWRIPYIRUTK-IWQDERRMSA-N |
| Database reference: |
| EROP-Moscow: ID E07151 MBPDB: Peptide INNQFLPYPY |