BIOPEP-UWM: Report
| ID | 9233 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 359.4841 | Monoisotopic mass | 359.1872 | |
| IC50 : | 69.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., FitzGerald R. J. | |
| Title | |
| Structure activity relationship modelling of milk protein-derived peptides with dipeptidyl peptidase IV (DPP-IV) inhibitory activity. Peptides, 2016, 79, 1-7. | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCSC)C(O)=O InChI=1S/C16H29N3O4S/c1-4-10(2)13(17)15(21)19-8-5-6-12(19)14(20)18-11(16(22)23)7-9-24-3/h10-13H,4-9,17H2,1-3H3,(H,18,20)(H,22,23)/t10-,11-,12-,13-/m0/s1 InChIKey: CZWANIQKACCEKW-CYDGBPFRSA-N |
| Database reference: |