BIOPEP-UWM: Report
| ID | 9235 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 8 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 891.0628 | Monoisotopic mass | 890.5209 | |
| IC50 : | 4.60 µM |
|||
| Bibliographic data: | |
| Authors | |
| Uenishi H., Kabuki T., Seto Y., Serizawa A., Nakajima H. | |
| Title | |
| Isolation and identification of casein-derived dipeptidyl-peptidase 4 (DPP-4)-inhibitory peptide LPQNIPPL from gouda-type cheese and its effect on plasma glucose in rats. International Dairy Journal, 2012, 22, 24-30. | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C42H70N10O11/c1-7-24(6)34(41(61)52-18-10-13-31(52)40(60)51-17-9-12-30(51)38(58)48-28(42(62)63)20-23(4)5)49-36(56)27(21-33(45)54)47-35(55)26(14-15-32(44)53)46-37(57)29-11-8-16-50(29)39(59)25(43)19-22(2)3/h22-31,34H,7-21,43H2,1-6H3,(H2,44,53)(H2,45,54)(H,46,57)(H,47,55)(H,48,58)(H,49,56)(H,62,63)/t24-,25-,26-,27-,28-,29-,30-,31-,34-/m0/s1 InChIKey: MGFYOVDWEVJBGE-JSPIMOTESA-N |
| Database reference: |