BIOPEP-UWM: Report
| ID | 9236 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 581.7046 | Monoisotopic mass | 581.3316 | |
| IC50 : | 116.90 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Sadiq F. A., Liu T. J., Chen J. C., He G. Q. | |
| Title | |
| Purification and identification of novel peptides with inhibitory effect against angiotensin I-converting enzyme and optimization of process conditions in milk fermented with the yeast Kluyveromyces marxianus. J. Funct. Foods. 2015, 16:278-288. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C30H43N7O5/c1-19(2)16-22(31)26(38)35-23(14-9-15-34-30(32)33)27(39)36-24(17-20-10-5-3-6-11-20)28(40)37-25(29(41)42)18-21-12-7-4-8-13-21/h3-8,10-13,19,22-25H,9,14-18,31H2,1-2H3,(H,35,38)(H,36,39)(H,37,40)(H,41,42)(H4,32,33,34)/t22-,23-,24-,25-/m0/s1 InChIKey=AFMAIKCAEUPEPI-QORCZRPOSA-N |
| Database reference: |
| MBPDB: Peptide LRFF |