BIOPEP-UWM: Report
| ID | 9237 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 11 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1197.4188 | Monoisotopic mass | 1196.6783 | |
| IC50 : | 0.36 µM |
|||
| Bibliographic data: | |
| Authors | |
| QuirĂ³s A., Contreras M. M., Ramos M., Amigo L., Recio I. | |
| Title | |
| Stability to gastrointestinal enzymes and structure-activity relationship of β-casein-peptides with antihypertensive properties. Peptides, 2009, 30:1848-1853. | |
| Year | Source |
| 2009 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C58H92N12O15/c1-29(2)27-36(59)48(74)66-46(33(9)71)54(80)61-37(22-23-42(60)73)49(75)67-47(34(10)72)57(83)69-25-15-20-40(69)51(77)63-43(30(3)4)52(78)64-44(31(5)6)53(79)65-45(32(7)8)56(82)70-26-16-21-41(70)55(81)68-24-14-19-39(68)50(76)62-38(58(84)85)28-35-17-12-11-13-18-35/h11-13,17-18,29-34,36-41,43-47,71-72H,14-16,19-28,59H2,1-10H3,(H2,60,73)(H,61,80)(H,62,76)(H,63,77)(H,64,78)(H,65,79)(H,66,74)(H,67,75)(H,84,85)/t33-,34-,36+,37+,38+,39+,40+,41+,43+,44+,45+,46+,47+/m1/s1 InChIKey: WHVRIIHQDFXLFY-PSQVKVLZSA-N |
| Database reference: |
| AHTPDB: ID 4364, 5819 SATPdb: ID satpdb14538 |