BIOPEP-UWM: Report
| ID | 9251 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 656.8106 | Monoisotopic mass | 656.3885 | |
| EC50 : | 1.18 µM |
|||
| Bibliographic data: | |
| Authors | |
| Quirós A., Contreras M. M., Ramos M., Amigo L., Recio I. | |
| Title | |
| Stability to gastrointestinal enzymes and structure-activity relationship of β-casein-peptides with antihypertensive properties. Peptides. 2009, 30:1848-1853. | |
| Year | Source |
| 2009 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C34H52N6O7/c1-19(2)26(35)30(42)37-27(20(3)4)31(43)38-28(21(5)6)33(45)40-17-11-15-25(40)32(44)39-16-10-14-24(39)29(41)36-23(34(46)47)18-22-12-8-7-9-13-22/h7-9,12-13,19-21,23-28H,10-11,14-18,35H2,1-6H3,(H,36,41)(H,37,42)(H,38,43)(H,46,47)/t23-,24-,25-,26-,27-,28-/m0/s1 InChIKey: JSZQEWKLZMKMKS-QUQVWLGBSA-N |
| Database reference: |
| AHTPDB: ID 2534, 4335, 5817 SATPdb: ID satpdb16462 |