BIOPEP-UWM: Report
| ID | 9254 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 973.0790 | Monoisotopic mass | 972.4690 | |
| IC50 : | 20.08 µM |
|||
| Bibliographic data: | |
| Authors | |
| Contreras M. M., CarrĂ³n R., Montero M. J., Ramos M., Recio I. | |
| Title | |
| Novel casein-derived peptides with antihypertensive activity. Int. Dairy J. 2009; 19: 566-573. | |
| Year | Source |
| 2009 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C48H64N10O12/c49-23-5-4-9-34(54-44(65)35(19-21-40(51)61)53-42(63)33(50)25-29-11-15-31(59)16-12-29)43(64)56-37(26-28-7-2-1-3-8-28)47(68)58-24-6-10-39(58)46(67)55-36(20-22-41(52)62)45(66)57-38(48(69)70)27-30-13-17-32(60)18-14-30/h1-3,7-8,11-18,33-39,59-60H,4-6,9-10,19-27,49-50H2,(H2,51,61)(H2,52,62)(H,53,63)(H,54,65)(H,55,67)(H,56,64)(H,57,66)(H,69,70)/t33-,34-,35-,36-,37-,38-,39-/m0/s1 InChIKey: TZXMOJGCTZFVLR-ZTYVOHGWSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9261); the MBPDB database |
| Database reference: |
| AHTPDB: ID 1720, 1759, 2380, 2613, 2620, 4148, 4280, 5034 BioPepDB: ID biopep01624 BIOPEP-UWM database of bioactive peptides: ID 9261 EROP-Moscow: ID E14712 MBPDB: Peptide YQKFPQY SATPdb: ID satpdb26998 |