BIOPEP-UWM: Report
| ID | 9266 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 504.4870 | Monoisotopic mass | 504.2059 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xing L., Hu Y., Hu H., Ge Q., Zhou G., Zhang W. | |
| Title | |
| Purification and identification of antioxidative peptides from dry-cured Xuanwei ham. Food Chem., 194, 951–958, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C20H32N4O11/c1-9(2)7-13(24-17(31)10(21)8-16(29)30)19(33)22-11(3-5-14(25)26)18(32)23-12(20(34)35)4-6-15(27)28/h9-13H,3-8,21H2,1-2H3,(H,22,33)(H,23,32)(H,24,31)(H,25,26)(H,27,28)(H,29,30)(H,34,35)/t10-,11-,12-,13-/m0/s1 InChIKey: SUAGZRRFDJMKIH-CYDGBPFRSA-N |
| Database reference: |