BIOPEP-UWM: Report
| ID | 9267 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1247.2711 | Monoisotopic mass | 1246.5673 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Orsini Delgado M. C., Nardo A., Pavlovic M., Rogniaux H., Añón M. C., Tironi V. A. | |
| Title | |
| Identification and characterization of antioxidant peptides obtained by gastrointestinal digestion of amaranth proteins. Food Chem., 197, 1160-1167, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C51H78N18O19/c1-24(52)41(79)69-34(20-25-21-60-27-7-3-2-6-26(25)27)47(85)67-32(13-17-40(77)78)46(84)66-30(11-15-38(73)74)44(82)63-28(8-4-18-58-50(54)55)43(81)65-31(12-16-39(75)76)45(83)64-29(10-14-36(53)71)42(80)61-22-37(72)62-35(23-70)48(86)68-33(49(87)88)9-5-19-59-51(56)57/h2-3,6-7,21,24,28-35,60,70H,4-5,8-20,22-23,52H2,1H3,(H2,53,71)(H,61,80)(H,62,72)(H,63,82)(H,64,83)(H,65,81)(H,66,84)(H,67,85)(H,68,86)(H,69,79)(H,73,74)(H,75,76)(H,77,78)(H,87,88)(H4,54,55,58)(H4,56,57,59)/t24-,28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 InChIKey: ZHUQJHRGQGIPQI-FDOKFPFMSA-N |
| Database reference: |