BIOPEP-UWM: Report
| ID | 9268 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1170.2714 | Monoisotopic mass | 1169.5811 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Orsini Delgado M. C., Nardo A., Pavlovic M., Rogniaux H., Añón M. C., Tironi V. A. | |
| Title | |
| Identification and characterization of antioxidant peptides obtained by gastrointestinal digestion of amaranth proteins. Food Chem., 197, 1160-1167, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O InChI=1S/C52H79N15O16/c1-27(2)21-37(65-45(75)32(54)22-29-9-11-31(68)12-10-29)49(79)60-28(3)44(74)58-25-42(71)61-36(7-4-5-19-53)51(81)67-20-6-8-39(67)50(80)64-34(14-17-41(56)70)47(77)62-33(13-16-40(55)69)46(76)63-35(15-18-43(72)73)48(78)66-38(52(82)83)23-30-24-57-26-59-30/h9-12,24,26-28,32-39,68H,4-8,13-23,25,53-54H2,1-3H3,(H2,55,69)(H2,56,70)(H,57,59)(H,58,74)(H,60,79)(H,61,71)(H,62,77)(H,63,76)(H,64,80)(H,65,75)(H,66,78)(H,72,73)(H,82,83)/t28-,32-,33-,34-,35-,36-,37-,38-,39-/m0/s1 InChIKey: VNGLKJVSGJVQTI-BNKVYPKISA-N |
| Database reference: |