BIOPEP-UWM: Report
| ID | 9271 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1130.1252 | Monoisotopic mass | 1129.4886 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Orsini Delgado M. C., Nardo A., Pavlovic M., Rogniaux H., Añón M. C., Tironi V. A. | |
| Title | |
| Identification and characterization of antioxidant peptides obtained by gastrointestinal digestion of amaranth proteins. Food Chem., 197, 1160-1167, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CCC(=O)N)C(=O)O InChI=1S/C46H67N17O17/c47-19-35(67)56-30(17-36(68)69)43(77)57-24(7-4-14-54-46(51)52)38(72)61-28(15-22-5-2-1-3-6-22)41(75)58-26(9-12-33(49)65)40(74)63-31(18-37(70)71)44(78)59-25(8-11-32(48)64)39(73)62-29(16-23-20-53-21-55-23)42(76)60-27(45(79)80)10-13-34(50)66/h1-3,5-6,20-21,24-31H,4,7-19,47H2,(H2,48,64)(H2,49,65)(H2,50,66)(H,53,55)(H,56,67)(H,57,77)(H,58,75)(H,59,78)(H,60,76)(H,61,72)(H,62,73)(H,63,74)(H,68,69)(H,70,71)(H,79,80)(H4,51,52,54)/t24-,25-,26-,27-,28-,29-,30-,31-/m0/s1 InChIKey: FPQTXKUIANOJLI-NLXVKQHPSA-N |
| Database reference: |