BIOPEP-UWM: Report
| ID | 9272 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1004.1837 | Monoisotopic mass | 1003.5910 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Orsini Delgado M. C., Nardo A., Pavlovic M., Rogniaux H., Añón M. C., Tironi V. A. | |
| Title | |
| Identification and characterization of antioxidant peptides obtained by gastrointestinal digestion of amaranth proteins. Food Chem., 197, 1160-1167, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@]([H])(CO)NC(=O)[C@]1([H])CCCN1C(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(CCCCN)NC(=O)[C@@]([H])(NC(=O)[C@@]([H])(NC(=O)[C@@H](N)Cc1c[nH]cn1)C(C)C)[C@@]([H])(C)CC)C(O)=O InChI=1S/C45H77N15O11/c1-6-25(4)35(58-40(66)34(24(2)3)57-36(62)28(47)20-27-21-50-23-52-27)41(67)55-30(12-7-8-16-46)42(68)60-19-11-15-33(60)43(69)59-18-10-14-32(59)39(65)56-31(22-61)38(64)54-29(13-9-17-51-45(48)49)37(63)53-26(5)44(70)71/h21,23-26,28-35,61H,6-20,22,46-47H2,1-5H3,(H,50,52)(H,53,63)(H,54,64)(H,55,67)(H,56,65)(H,57,62)(H,58,66)(H,70,71)(H4,48,49,51)/t25-,26-,28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 InChIKey=SIBBAPIMFWWFCO-JSHULJIJSA-N |
| Database reference: |