BIOPEP-UWM: Report
| ID | 9274 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial activity against S. aureus | |||
| Number of residues | 5 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 642.6983 | Monoisotopic mass | 642.3003 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Matin M., Monnai M., Otani H. | |
| Title | |
| Isolation and characterization of a cytotoxic pentapeptide, κ-casecidin, from bovine κ-casein digested with bovine trypsin. Nihon Chikusan Gakkaiho, 71, 197–207, 2000 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C31H42N6O9/c32-14-8-7-13-22(31(45)46)34-29(43)24(17-26(39)40)36-30(44)25(18-38)37-28(42)23(16-20-11-5-2-6-12-20)35-27(41)21(33)15-19-9-3-1-4-10-19/h1-6,9-12,21-25,38H,7-8,13-18,32-33H2,(H,34,43)(H,35,41)(H,36,44)(H,37,42)(H,39,40)(H,45,46)/t21-,22-,23-,24-,25-/m0/s1 InChIKey=RUYQVNBTZYMZTC-KEOOTSPTSA-N Immunomodulating peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3812) Cytotoxic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 7497) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 3812; 7497 EROP-Moscow: ID E14744 J-GLOBAL: ID 200907088886196304 Nikkaji: Id J1.352.596J PubChem: CID 14389291 |