BIOPEP-UWM: Report
| ID | 9286 |
| Name | Antifungal peptide |
| sequence |
| Function: | |||
| Antifungal | |||
| Number of residues | 11 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 1391.8235 | Monoisotopic mass | 1390.9400 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Badosa E., Ferré R., Francés J., Bardají E., Feliu L., Planas M., Montesinos E. | |
| Title | |
| Sporicidal activity of synthetic antifungal undecapeptides and control of Penicillium rot of apples. Applied and Environmental Microbiology, 75, 5563–5569, 2009 | |
| Year | Source |
| 2009 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(N)=O InChI=1S/C71H122N16O12/c1-11-46(10)60(71(99)85-57(39-44(6)7)67(95)81-53(27-17-21-35-74)65(93)86-59(45(8)9)70(98)82-55(61(77)89)37-42(2)3)87-66(94)54(28-18-22-36-75)79-63(91)52(26-16-20-34-73)80-69(97)58(41-47-23-13-12-14-24-47)84-68(96)56(38-43(4)5)83-64(92)51(25-15-19-33-72)78-62(90)50(76)40-48-29-31-49(88)32-30-48/h12-14,23-24,29-32,42-46,50-60,88H,11,15-22,25-28,33-41,72-76H2,1-10H3,(H2,77,89)(H,78,90)(H,79,91)(H,80,97)(H,81,95)(H,82,98)(H,83,92)(H,84,96)(H,85,99)(H,86,93)(H,87,94)/t46-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-/m0/s1 InChIKey: FOPGEWCAEDEBLV-OEBWVTANSA-N Hemolytic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9288) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9288 |