BIOPEP-UWM: Report
| ID | 9292 |
| Name | Antifungal peptide |
| sequence |
| Function: | |||
| Antifungal | |||
| Number of residues | 11 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 1443.9012 | Monoisotopic mass | 1442.9825 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Badosa E., Ferré R., Francés J., Bardají E., Feliu L., Planas M., Montesinos E. | |
| Title | |
| Sporicidal activity of synthetic antifungal undecapeptides and control of Penicillium rot of apples. Applied and Environmental Microbiology, 75, 5563–5569, 2009 | |
| Year | Source |
| 2009 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1c[nH]c2ccccc12)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(N)=O InChI=1S/C74H126N18O11/c1-9-48(8)63(74(103)91-61(41-47(6)7)71(100)86-55(30-16-21-35-76)66(95)84-57(32-18-23-37-78)68(97)88-59(64(81)93)39-45(2)3)92-70(99)58(33-19-24-38-79)85-67(96)56(31-17-22-36-77)87-73(102)62(42-49-25-11-10-12-26-49)90-72(101)60(40-46(4)5)89-69(98)54(29-15-20-34-75)83-65(94)52(80)43-50-44-82-53-28-14-13-27-51(50)53/h10-14,25-28,44-48,52,54-63,82H,9,15-24,29-43,75-80H2,1-8H3,(H2,81,93)(H,83,94)(H,84,95)(H,85,96)(H,86,100)(H,87,102)(H,88,97)(H,89,98)(H,90,101)(H,91,103)(H,92,99)/t48-,52-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-/m0/s1 InChIKey: NFSJHKVQTUQJKL-GNHLHROZSA-N |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9293 |