BIOPEP-UWM: Report
| ID | 9300 |
| Name | Antifungal peptide |
| sequence |
| Function: | |||
| Antifungal | |||
| Number of residues | 11 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 1341.8078 | Monoisotopic mass | 1340.9607 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Badosa E., Ferré R., Francés J., Bardají E., Feliu L., Planas M., Montesinos E. | |
| Title | |
| Sporicidal activity of synthetic antifungal undecapeptides and control of Penicillium rot of apples. Applied and Environmental Microbiology, 75, 5563–5569, 2009 | |
| Year | Source |
| 2009 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(N)=O InChI=1S/C68H124N16O11/c1-13-45(12)57(68(95)82-54(38-43(8)9)64(91)78-50(29-19-23-33-71)62(89)83-56(44(10)11)67(94)79-52(58(74)85)36-41(4)5)84-63(90)51(30-20-24-34-72)76-60(87)49(28-18-22-32-70)77-66(93)55(39-46-25-15-14-16-26-46)81-65(92)53(37-42(6)7)80-61(88)48(27-17-21-31-69)75-59(86)47(73)35-40(2)3/h14-16,25-26,40-45,47-57H,13,17-24,27-39,69-73H2,1-12H3,(H2,74,85)(H,75,86)(H,76,87)(H,77,93)(H,78,91)(H,79,94)(H,80,88)(H,81,92)(H,82,95)(H,83,89)(H,84,90)/t45-,47-,48-,49-,50-,51-,52-,53-,54-,55-,56-,57-/m0/s1 InChIKey: NLADUGFMICSPKM-TZMVSQBHSA-N Hemolytic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9301) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9301 |