BIOPEP-UWM: Report
| ID | 9309 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 486.5708 | Monoisotopic mass | 486.3132 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wu J., Aluko R. E. | |
| Title | |
| Quantitative structure-activity relationship study of bitter di- and tri-peptides including relationship with angiotensin I-converting enzyme inhibitory activity. J. Peptide Sci., 13, 63-69, 2007 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: C(=O)([C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)N)O InChI=1S/C18H38N12O4/c19-10(4-1-7-26-16(20)21)13(31)29-11(5-2-8-27-17(22)23)14(32)30-12(15(33)34)6-3-9-28-18(24)25/h10-12H,1-9,19H2,(H,29,31)(H,30,32)(H,33,34)(H4,20,21,26)(H4,22,23,27)(H4,24,25,28)/t10-,11-,12-/m0/s1 InChiKey: XPSGESXVBSQZPL-SRVKXCTJSA-N Bitter peptide according to the BIOPEP –UWM database of sensory peptides and amino acids (ID 3) |
| Database reference: |
| AHTPDB: ID 4571; 4830; 5485 BIOPEP-UWM database of sensory peptides and amino acids: ID 3 BRENDA: Ligand Arg-Arg-Arg ChEMBL: ID CHEMBL1269805 ChemSpider: ID 388687 J-GLOBAL: ID 200907012272643812 Nikkaji: ID J323.012K PubChem: CID 439610 SATPdb: ID satpdb22849 |