BIOPEP-UWM: Report
| ID | 9328 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 408.4048 | Monoisotopic mass | 408.1639 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu C., Ren D., Li J., Fang L., Wang J., Liu J., Min W. | |
| Title | |
| Cytoprotective effect and purification of novel antioxidant peptides from hazelnut (C. heterophylla Fisch) protein hydrolysates. J. Funct. Foods, 42, 203–215, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O InChI=1S/C18H24N4O7/c1-10(19)16(26)22-12(8-15(24)25)17(27)20-9-14(23)21-13(18(28)29)7-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9,19H2,1H3,(H,20,27)(H,21,23)(H,22,26)(H,24,25)(H,28,29)/t10-,12-,13-/m0/s1 InChIKey: JZGXPPGVPOKWOM-DRZSPHRISA-N |
| Database reference: |