BIOPEP-UWM: Report
| ID | 9330 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 616.6182 | Monoisotopic mass | 616.2484 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu C., Ren D., Li J., Fang L., Wang J., Liu J., Min W. | |
| Title | |
| Cytoprotective effect and purification of novel antioxidant peptides from hazelnut (C. heterophylla Fisch) protein hydrolysates. J. Funct. Foods, 42, 203–215, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N[C@@]([H])(Cc1c[nH]c2ccccc12)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(O)=O)C(O)=O InChI=1S/C28H36N6O10/c1-14(29)24(39)32-19(11-15-13-30-17-6-3-2-5-16(15)17)25(40)33-20(12-23(37)38)27(42)34-10-4-7-21(34)26(41)31-18(28(43)44)8-9-22(35)36/h2-3,5-6,13-14,18-21,30H,4,7-12,29H2,1H3,(H,31,41)(H,32,39)(H,33,40)(H,35,36)(H,37,38)(H,43,44)/t14-,18-,19-,20-,21-/m0/s1 InChIKey: UJJRYDXQTSDLLP-ZTIIYBLCSA-N |
| Database reference: |