BIOPEP-UWM: Report
| ID | 9334 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 330.3790 | Monoisotopic mass | 330.1897 | |
| IC50 : | 141.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Caron J., Cudennec B., Domenger D., Belguesmia Y., Flahaut C., Kouach, M., Lesage J., Goossens J-F, Dhulster P., Ravallec R. | |
| Title | |
| Simulated GI digestion of dietary protein: release of new bioactive peptides involved in gut hormone secretion. Food Research International, 89, 2016, 382-390. | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C14H26N4O5/c1-6(2)10(15)13(21)17-8(4)11(19)16-7(3)12(20)18-9(5)14(22)23/h6-10H,15H2,1-5H3,(H,16,19)(H,17,21)(H,18,20)(H,22,23)/t7-,8-,9-,10-/m0/s1 InChIKey: QDECZYDBLKJAPF-XKNYDFJKSA-N |
| Database reference: |