BIOPEP-UWM: Report
| ID | 9335 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 659.6858 | Monoisotopic mass | 659.2905 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu C., Ren D., Li J., Fang L., Wang J., Liu J., Min W. | |
| Title | |
| Cytoprotective effect and purification of novel antioxidant peptides from hazelnut (C. heterophylla Fisch) protein hydrolysates. J. Funct. Foods, 42, 203–215, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(O)=O)C(=O)N[C@@]([H])(Cc1c[nH]c2ccccc12)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C30H41N7O10/c31-10-4-3-8-20(30(46)47)34-28(44)23-9-5-11-37(23)29(45)22(14-25(40)41)36-27(43)21(35-26(42)18(32)13-24(38)39)12-16-15-33-19-7-2-1-6-17(16)19/h1-2,6-7,15,18,20-23,33H,3-5,8-14,31-32H2,(H,34,44)(H,35,42)(H,36,43)(H,38,39)(H,40,41)(H,46,47)/t18-,20-,21-,22-,23-/m0/s1 InChIKey: OWAPJTNQCVHYNV-SVXFZJLFSA-N |
| Database reference: |