BIOPEP-UWM: Report
| ID | 9338 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 300.3102 | Monoisotopic mass | 300.1429 | |
| IC50 : | 41.10 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li-Chan E. C. Y., Huang S. L., Jao C. L., Ho K. P., Hsu K. C. | |
| Title | |
| Peptides derived from Atlantic salmon skin gelatin as dipeptidyl-peptidase IV inhibitors. J. AgrIc. Food Chem., 2012, 60, 973-978 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)O InChI=1S/C12H20N4O5/c1-7(11(20)14-6-10(18)19)15-12(21)8-3-2-4-16(8)9(17)5-13/h7-8H,2-6,13H2,1H3,(H,14,20)(H,15,21)(H,18,19)/t7-,8-/m0/s1 InChIKey: VRQWFBMYPHKZSP-YUMQZZPRSA-N |
| Database reference: |