BIOPEP-UWM: Report
| ID | 9339 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 356.4162 | Monoisotopic mass | 356.2053 | |
| EC50 : | 82.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Uenishi H., Kabuki T., Seto Y., Serizawa A., Nakajima H. | |
| Title | |
| Isolation and identification of casein-derived dipeptidyl-pepdiase-4 (DPP-4)-inhibitory peptide LPQNIPPL from gouda-type cheese and its effect on plasma glucose in rats. Int Dairy J., 2012; 22: 24-30. | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(N)=O)C(O)=O InChI=1S/C16H28N4O5/c1-9(2)8-10(17)15(23)20-7-3-4-12(20)14(22)19-11(16(24)25)5-6-13(18)21/h9-12H,3-8,17H2,1-2H3,(H2,18,21)(H,19,22)(H,24,25)/t10-,11-,12-/m0/s1 InChIKey: XWEVVRRSIOBJOO-SRVKXCTJSA-N |
| Database reference: |
| MBPDB: Peptide LPQ |