BIOPEP-UWM: Report
| ID | 9341 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 721.7567 | Monoisotopic mass | 721.3384 | |
| EC50 : | 1000.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Uenishi H, Kabuki T, Seto Y, Serizawa A, Nakajima H. | |
| Title | |
| Isolation and identification of casein-derived dipeptidyl-pepdiase-4 (DPP-4)- inhibitory peptide LPQNIPPL from gouda-type cheese and its effect on plasma glucose in rats. Int Dairy J 2012; 22: 24-30. | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C(=O)O)(NC([C@@](NC([C@@](NC([C@]([C@H](CC)C)(NC([C@]1(N(C(CNC([C@]2(NCCC2)[H])=O)=O)CCC1)[H])=O)[H])=O)(Cc1[nH]cnc1)[H])=O)(CC(=O)O)[H])=O)CO InChI=1S/C31H47N9O11/c1-3-16(2)25(39-29(48)22-7-5-9-40(22)23(42)13-34-26(45)18-6-4-8-33-18)30(49)37-19(10-17-12-32-15-35-17)27(46)36-20(11-24(43)44)28(47)38-21(14-41)31(50)51/h12,15-16,18-22,25,33,41H,3-11,13-14H2,1-2H3,(H,32,35)(H,34,45)(H,36,46)(H,37,49)(H,38,47)(H,39,48)(H,43,44)(H,50,51)/t16-,18-,19-,20-,21-,22-,25-/m0/s1 InChIKey: ISXLGNWBLNNFFT-HNJCEHCYSA-N |
| Database reference: |