BIOPEP-UWM: Report
| ID | 9351 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 440.4944 | Monoisotopic mass | 440.2166 | |
| EC50 : | 0.91 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xie J., Chen X., Wu J., Zhang Y., Zhou Y., Zhang L., Tang Y.-J., Wei D. | |
| Title | |
| Antihypertensive effects, molecular docking study, and isothermal titration calorimetry assay of angiotensin I-converting enzyme inhibitory peptides from Chlorella vulgaris. J. Agric. Food Chem., 66, 1359-1368, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](Cc1c[nH]c2ccccc12)(NC(=O)[C@]([H])(Cc1cnc[nH]1)NC(=O)[C@@]([H])(N)C(C)C)C(O)=O InChI=1S/C22H28N6O4/c1-12(2)19(23)21(30)27-17(8-14-10-24-11-26-14)20(29)28-18(22(31)32)7-13-9-25-16-6-4-3-5-15(13)16/h3-6,9-12,17-19,25H,7-8,23H2,1-2H3,(H,24,26)(H,27,30)(H,28,29)(H,31,32)/t17-,18-,19-/m0/s1 InChIKey: MJXNDRCLGDSBBE-FHWLQOOXSA-N |
| Database reference: |