BIOPEP-UWM: Report
| ID | 9354 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 381.4695 | Monoisotopic mass | 381.1023 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tian M., Fang B., Jiang L., Guo H., Cui J., Ren F. | |
| Title | |
| Structure-activity relationship of a series of antioxidant tripeptides derived from β-lactoglobulin using QSAR modeling. Dairy Science and Technology (2015) 95:451–463. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CS)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCC(O)=O)C(O)=O InChI= 1S/C13H23N3O6S2/c1-24-5-4-8(15-11(19)7(14)6-23)12(20)16-9(13(21)22)2-3-10(17)18/h7-9,23H,2-6,14H2,1H3,(H,15,19)(H,16,20)(H,17,18)(H,21,22)/t7-,8-,9-/m0/s1 InChIKey: POSRGGKLRWCUBE-CIUDSAMLSA-N Relative antioxidative activity was: 97.72 mmol Fe/mol peptide |
| Database reference: |